C15H19NO — CID 61308618
N-(2-bicyclo[2.2.1]heptanyl)-2,3-dihydro-1-benzofuran-5-amine (PubChem CID 61308618) has the molecular formula C15H19NO and a molecular weight of 229.32 g/mol. Its IUPAC name is N-(2-bicyclo[2.2.1]heptanyl)-2,3-dihydro-1-benzofuran-5-amine.
| Compound Name | N-(2-bicyclo[2.2.1]heptanyl)-2,3-dihydro-1-benzofuran-5-amine |
|---|---|
| PubChem CID | 61308618 |
| Molecular Formula | C15H19NO |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | N-(2-bicyclo[2.2.1]heptanyl)-2,3-dihydro-1-benzofuran-5-amine |
| SMILES | c1cc2c(cc1NC1CC3CCC1C3)CCO2 |
| InChI | InChI=1S/C15H19NO/c1-2-11-7-10(1)8-14(11)16-13-3-4-15-12(9-13)5-6-17-15/h3-4,9-11,14,16H,1-2,5-8H2 |
| InChIKey | PHHKDLVUDDUKOR-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|