C18H26N2O — CID 79537602
N-(2-piperidin-2-ylcyclopentyl)-2,3-dihydro-1-benzofuran-5-amine (PubChem CID 79537602) has the molecular formula C18H26N2O and a molecular weight of 286.42 g/mol. Its IUPAC name is N-(2-piperidin-2-ylcyclopentyl)-2,3-dihydro-1-benzofuran-5-amine.
| Compound Name | N-(2-piperidin-2-ylcyclopentyl)-2,3-dihydro-1-benzofuran-5-amine |
|---|---|
| PubChem CID | 79537602 |
| Molecular Formula | C18H26N2O |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | N-(2-piperidin-2-ylcyclopentyl)-2,3-dihydro-1-benzofuran-5-amine |
| SMILES | c1cc2c(cc1NC1CCCC1C1CCCCN1)CCO2 |
| InChI | InChI=1S/C18H26N2O/c1-2-10-19-16(5-1)15-4-3-6-17(15)20-14-7-8-18-13(12-14)9-11-21-18/h7-8,12,15-17,19-20H,1-6,9-11H2 |
| InChIKey | ZFRRBGWZCWUVGT-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|