About N-(2-pyrrolidin-2-ylcyclopentyl)-1,3-benzodioxol-5-amine
N-(2-pyrrolidin-2-ylcyclopentyl)-1,3-benzodioxol-5-amine (PubChem CID 79536079) has the molecular formula C16H22N2O2
and a molecular weight of 274.36 g/mol. Its IUPAC name is N-(2-pyrrolidin-2-ylcyclopentyl)-1,3-benzodioxol-5-amine.
Molecular Properties
| Compound Name | N-(2-pyrrolidin-2-ylcyclopentyl)-1,3-benzodioxol-5-amine |
| PubChem CID | 79536079 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | N-(2-pyrrolidin-2-ylcyclopentyl)-1,3-benzodioxol-5-amine |
| SMILES | c1cc2c(cc1NC1CCCC1C1CCCN1)OCO2 |
| InChI | InChI=1S/C16H22N2O2/c1-3-12(13-5-2-8-17-13)14(4-1)18-11-6-7-15-16(9-11)20-10-19-15/h6-7,9,12-14,17-18H,1-5,8,10H2 |
| InChIKey | FGIPWNOVAPMWIX-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze N-(2-pyrrolidin-2-ylcyclopentyl)-1,3-benzodioxol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-pyrrolidin-2-ylcyclopentyl)-1,3-benzodioxol-5-amine?
The IUPAC name of N-(2-pyrrolidin-2-ylcyclopentyl)-1,3-benzodioxol-5-amine (CID 79536079) is N-(2-pyrrolidin-2-ylcyclopentyl)-1,3-benzodioxol-5-amine.
What is the SMILES notation for N-(2-pyrrolidin-2-ylcyclopentyl)-1,3-benzodioxol-5-amine?
The canonical SMILES for N-(2-pyrrolidin-2-ylcyclopentyl)-1,3-benzodioxol-5-amine is c1cc2c(cc1NC1CCCC1C1CCCN1)OCO2.
What is the InChIKey of N-(2-pyrrolidin-2-ylcyclopentyl)-1,3-benzodioxol-5-amine?
The InChIKey is FGIPWNOVAPMWIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N2O2/c1-3-12(13-5-2-8-17-13)14(4-1)18-11-6-7-15-16(9-11)20-10-19-15/h6-7,9,12-14,17-18H,1-5,8,10H2.
What are the key properties of N-(2-pyrrolidin-2-ylcyclopentyl)-1,3-benzodioxol-5-amine?
N-(2-pyrrolidin-2-ylcyclopentyl)-1,3-benzodioxol-5-amine has a molecular weight of 274.36 g/mol, XLogP of 2.75, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-pyrrolidin-2-ylcyclopentyl)-1,3-benzodioxol-5-amine is sourced from PubChem (CID 79536079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).