C17H21NO2 — CID 43503205
N-(8-tricyclo[5.2.1.02,6]decanyl)-1,3-benzodioxol-5-amine (PubChem CID 43503205) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is N-(8-tricyclo[5.2.1.02,6]decanyl)-1,3-benzodioxol-5-amine.
| Compound Name | N-(8-tricyclo[5.2.1.02,6]decanyl)-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 43503205 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | N-(8-tricyclo[5.2.1.02,6]decanyl)-1,3-benzodioxol-5-amine |
| SMILES | c1cc2c(cc1NC1CC3CC1C1CCCC31)OCO2 |
| InChI | InChI=1S/C17H21NO2/c1-2-12-10-6-14(13(12)3-1)15(7-10)18-11-4-5-16-17(8-11)20-9-19-16/h4-5,8,10,12-15,18H,1-3,6-7,9H2 |
| InChIKey | RLXFIKLQAOCQJR-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|