C13H17NO3 — CID 102730964
trans-(1S,2S)-2-(1,3-benzodioxol-5-ylamino)cyclohexan-1-ol (PubChem CID 102730964) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is trans-(1S,2S)-2-(1,3-benzodioxol-5-ylamino)cyclohexan-1-ol.
| Compound Name | trans-(1S,2S)-2-(1,3-benzodioxol-5-ylamino)cyclohexan-1-ol |
|---|---|
| PubChem CID | 102730964 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | trans-(1S,2S)-2-(1,3-benzodioxol-5-ylamino)cyclohexan-1-ol |
| SMILES | O[C@H]1CCCC[C@@H]1Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C13H17NO3/c15-11-4-2-1-3-10(11)14-9-5-6-12-13(7-9)17-8-16-12/h5-7,10-11,14-15H,1-4,8H2/t10-,11-/m0/s1 |
| InChIKey | KLQVLHRXKQUIGB-QWRGUYRKSA-N |
| XLogP | 2.13 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|