C14H19NO3 — CID 60886931
2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)cyclohexan-1-ol (PubChem CID 60886931) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is 2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)cyclohexan-1-ol.
| Compound Name | 2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)cyclohexan-1-ol |
|---|---|
| PubChem CID | 60886931 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | 2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)cyclohexan-1-ol |
| SMILES | OC1CCCCC1Nc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C14H19NO3/c16-12-4-2-1-3-11(12)15-10-5-6-13-14(9-10)18-8-7-17-13/h5-6,9,11-12,15-16H,1-4,7-8H2 |
| InChIKey | XBXNAVXRESMIHI-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|