C12H13F2NO3 — CID 102732980
trans-(1S,2S)-2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]cyclopentan-1-ol (PubChem CID 102732980) has the molecular formula C12H13F2NO3 and a molecular weight of 257.24 g/mol. Its IUPAC name is trans-(1S,2S)-2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]cyclopentan-1-ol.
| Compound Name | trans-(1S,2S)-2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]cyclopentan-1-ol |
|---|---|
| PubChem CID | 102732980 |
| Molecular Formula | C12H13F2NO3 |
| Molecular Weight | 257.24 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | trans-(1S,2S)-2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]cyclopentan-1-ol |
| SMILES | O[C@H]1CCC[C@@H]1Nc1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C12H13F2NO3/c13-12(14)17-10-5-4-7(6-11(10)18-12)15-8-2-1-3-9(8)16/h4-6,8-9,15-16H,1-3H2/t8-,9-/m0/s1 |
| InChIKey | AWSMUBRTBSVJFS-IUCAKERBSA-N |
| XLogP | 2.33 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.24 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|