C12H13F2NO2S — CID 62871583
2,2-difluoro-N-(thian-3-yl)-1,3-benzodioxol-5-amine (PubChem CID 62871583) has the molecular formula C12H13F2NO2S and a molecular weight of 273.30 g/mol. Its IUPAC name is 2,2-difluoro-N-(thian-3-yl)-1,3-benzodioxol-5-amine.
| Compound Name | 2,2-difluoro-N-(thian-3-yl)-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 62871583 |
| Molecular Formula | C12H13F2NO2S |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 2,2-difluoro-N-(thian-3-yl)-1,3-benzodioxol-5-amine |
| SMILES | FC1(F)Oc2ccc(NC3CCCSC3)cc2O1 |
| InChI | InChI=1S/C12H13F2NO2S/c13-12(14)16-10-4-3-8(6-11(10)17-12)15-9-2-1-5-18-7-9/h3-4,6,9,15H,1-2,5,7H2 |
| InChIKey | NBXFBZLGEMAFAR-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|