C13H16N2O2S — CID 62871056
6-(thian-3-ylamino)-4H-1,4-benzoxazin-3-one (PubChem CID 62871056) has the molecular formula C13H16N2O2S and a molecular weight of 264.35 g/mol. Its IUPAC name is 6-(thian-3-ylamino)-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-(thian-3-ylamino)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 62871056 |
| Molecular Formula | C13H16N2O2S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 6-(thian-3-ylamino)-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2ccc(NC3CCCSC3)cc2N1 |
| InChI | InChI=1S/C13H16N2O2S/c16-13-7-17-12-4-3-9(6-11(12)15-13)14-10-2-1-5-18-8-10/h3-4,6,10,14H,1-2,5,7-8H2,(H,15,16) |
| InChIKey | PMSKNBGFUHDXIN-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|