C14H18N2O3 — CID 112633272
6-[(3-hydroxy-2,2-dimethylcyclobutyl)amino]-4H-1,4-benzoxazin-3-one (PubChem CID 112633272) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is 6-[(3-hydroxy-2,2-dimethylcyclobutyl)amino]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[(3-hydroxy-2,2-dimethylcyclobutyl)amino]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 112633272 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 6-[(3-hydroxy-2,2-dimethylcyclobutyl)amino]-4H-1,4-benzoxazin-3-one |
| SMILES | CC1(C)C(O)CC1Nc1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C14H18N2O3/c1-14(2)11(6-12(14)17)15-8-3-4-10-9(5-8)16-13(18)7-19-10/h3-5,11-12,15,17H,6-7H2,1-2H3,(H,16,18) |
| InChIKey | NCAGYDVPCAZNKK-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|