C16H22N2O3 — CID 79908581
6-[(2,2,5,5-tetramethyloxolan-3-yl)amino]-4H-1,4-benzoxazin-3-one (PubChem CID 79908581) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is 6-[(2,2,5,5-tetramethyloxolan-3-yl)amino]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[(2,2,5,5-tetramethyloxolan-3-yl)amino]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 79908581 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 6-[(2,2,5,5-tetramethyloxolan-3-yl)amino]-4H-1,4-benzoxazin-3-one |
| SMILES | CC1(C)CC(Nc2ccc3c(c2)NC(=O)CO3)C(C)(C)O1 |
| InChI | InChI=1S/C16H22N2O3/c1-15(2)8-13(16(3,4)21-15)17-10-5-6-12-11(7-10)18-14(19)9-20-12/h5-7,13,17H,8-9H2,1-4H3,(H,18,19) |
| InChIKey | GMOZZWRSVDJGHI-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|