C12H13N3O2 — CID 115129016
2-methyl-2-[(3-oxo-4H-1,4-benzoxazin-6-yl)amino]propanenitrile (PubChem CID 115129016) has the molecular formula C12H13N3O2 and a molecular weight of 231.25 g/mol. Its IUPAC name is 2-methyl-2-[(3-oxo-4H-1,4-benzoxazin-6-yl)amino]propanenitrile.
| Compound Name | 2-methyl-2-[(3-oxo-4H-1,4-benzoxazin-6-yl)amino]propanenitrile |
|---|---|
| PubChem CID | 115129016 |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 2-methyl-2-[(3-oxo-4H-1,4-benzoxazin-6-yl)amino]propanenitrile |
| SMILES | CC(C)(C#N)Nc1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C12H13N3O2/c1-12(2,7-13)15-8-3-4-10-9(5-8)14-11(16)6-17-10/h3-5,15H,6H2,1-2H3,(H,14,16) |
| InChIKey | DLXOQIFHUJVANF-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|