C17H22N2O2 — CID 64594254
6-[(3-cyclopropylcyclohexyl)amino]-4H-1,4-benzoxazin-3-one (PubChem CID 64594254) has the molecular formula C17H22N2O2 and a molecular weight of 286.38 g/mol. Its IUPAC name is 6-[(3-cyclopropylcyclohexyl)amino]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[(3-cyclopropylcyclohexyl)amino]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 64594254 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 6-[(3-cyclopropylcyclohexyl)amino]-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2ccc(NC3CCCC(C4CC4)C3)cc2N1 |
| InChI | InChI=1S/C17H22N2O2/c20-17-10-21-16-7-6-14(9-15(16)19-17)18-13-3-1-2-12(8-13)11-4-5-11/h6-7,9,11-13,18H,1-5,8,10H2,(H,19,20) |
| InChIKey | ANSAVCJROQYLQJ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|