C14H19NS — CID 62871773
N-(2,3-dihydro-1H-inden-5-yl)thian-3-amine (PubChem CID 62871773) has the molecular formula C14H19NS and a molecular weight of 233.38 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-inden-5-yl)thian-3-amine.
| Compound Name | N-(2,3-dihydro-1H-inden-5-yl)thian-3-amine |
|---|---|
| PubChem CID | 62871773 |
| Molecular Formula | C14H19NS |
| Molecular Weight | 233.38 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | N-(2,3-dihydro-1H-inden-5-yl)thian-3-amine |
| SMILES | c1cc2c(cc1NC1CCCSC1)CCC2 |
| InChI | InChI=1S/C14H19NS/c1-3-11-6-7-13(9-12(11)4-1)15-14-5-2-8-16-10-14/h6-7,9,14-15H,1-5,8,10H2 |
| InChIKey | CVINBSJMCJSNHF-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.38 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |