About N-(thiolan-3-yl)-6,7-dihydro-5H-cyclopenta[b]pyridin-3-amine
N-(thiolan-3-yl)-6,7-dihydro-5H-cyclopenta[b]pyridin-3-amine (PubChem CID 115976225) has the molecular formula C12H16N2S
and a molecular weight of 220.34 g/mol. Its IUPAC name is N-(thiolan-3-yl)-6,7-dihydro-5H-cyclopenta[b]pyridin-3-amine.
Molecular Properties
| Compound Name | N-(thiolan-3-yl)-6,7-dihydro-5H-cyclopenta[b]pyridin-3-amine |
| PubChem CID | 115976225 |
| Molecular Formula | C12H16N2S |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | N-(thiolan-3-yl)-6,7-dihydro-5H-cyclopenta[b]pyridin-3-amine |
| SMILES | c1nc2c(cc1NC1CCSC1)CCC2 |
| InChI | InChI=1S/C12H16N2S/c1-2-9-6-11(7-13-12(9)3-1)14-10-4-5-15-8-10/h6-7,10,14H,1-5,8H2 |
| InChIKey | NXTQNJRSORYJIW-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(thiolan-3-yl)-6,7-dihydro-5H-cyclopenta[b]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(thiolan-3-yl)-6,7-dihydro-5H-cyclopenta[b]pyridin-3-amine?
The IUPAC name of N-(thiolan-3-yl)-6,7-dihydro-5H-cyclopenta[b]pyridin-3-amine (CID 115976225) is N-(thiolan-3-yl)-6,7-dihydro-5H-cyclopenta[b]pyridin-3-amine.
What is the SMILES notation for N-(thiolan-3-yl)-6,7-dihydro-5H-cyclopenta[b]pyridin-3-amine?
The canonical SMILES for N-(thiolan-3-yl)-6,7-dihydro-5H-cyclopenta[b]pyridin-3-amine is c1nc2c(cc1NC1CCSC1)CCC2.
What is the InChIKey of N-(thiolan-3-yl)-6,7-dihydro-5H-cyclopenta[b]pyridin-3-amine?
The InChIKey is NXTQNJRSORYJIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2S/c1-2-9-6-11(7-13-12(9)3-1)14-10-4-5-15-8-10/h6-7,10,14H,1-5,8H2.
What are the key properties of N-(thiolan-3-yl)-6,7-dihydro-5H-cyclopenta[b]pyridin-3-amine?
N-(thiolan-3-yl)-6,7-dihydro-5H-cyclopenta[b]pyridin-3-amine has a molecular weight of 220.34 g/mol, XLogP of 2.49, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(thiolan-3-yl)-6,7-dihydro-5H-cyclopenta[b]pyridin-3-amine is sourced from PubChem (CID 115976225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).