C10H11Cl2NOS — CID 107678926
2,6-dichloro-4-(thiolan-3-ylamino)phenol (PubChem CID 107678926) has the molecular formula C10H11Cl2NOS and a molecular weight of 264.18 g/mol. Its IUPAC name is 2,6-dichloro-4-(thiolan-3-ylamino)phenol.
| Compound Name | 2,6-dichloro-4-(thiolan-3-ylamino)phenol |
|---|---|
| PubChem CID | 107678926 |
| Molecular Formula | C10H11Cl2NOS |
| Molecular Weight | 264.18 g/mol |
| Exact Mass | 262.99 |
| IUPAC Name | 2,6-dichloro-4-(thiolan-3-ylamino)phenol |
| SMILES | Oc1c(Cl)cc(NC2CCSC2)cc1Cl |
| InChI | InChI=1S/C10H11Cl2NOS/c11-8-3-7(4-9(12)10(8)14)13-6-1-2-15-5-6/h3-4,6,13-14H,1-2,5H2 |
| InChIKey | JLOBUGRKWBCECL-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.18 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|