C10H11Cl2NO — CID 107679292
2,6-dichloro-4-(cyclobutylamino)phenol (PubChem CID 107679292) has the molecular formula C10H11Cl2NO and a molecular weight of 232.11 g/mol. Its IUPAC name is 2,6-dichloro-4-(cyclobutylamino)phenol.
| Compound Name | 2,6-dichloro-4-(cyclobutylamino)phenol |
|---|---|
| PubChem CID | 107679292 |
| Molecular Formula | C10H11Cl2NO |
| Molecular Weight | 232.11 g/mol |
| Exact Mass | 231.02 |
| IUPAC Name | 2,6-dichloro-4-(cyclobutylamino)phenol |
| SMILES | Oc1c(Cl)cc(NC2CCC2)cc1Cl |
| InChI | InChI=1S/C10H11Cl2NO/c11-8-4-7(5-9(12)10(8)14)13-6-2-1-3-6/h4-6,13-14H,1-3H2 |
| InChIKey | RAFYZHZOZDETQX-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.11 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|