C15H21Cl2NO — CID 107679381
2,6-dichloro-4-[(4-propan-2-ylcyclohexyl)amino]phenol (PubChem CID 107679381) has the molecular formula C15H21Cl2NO and a molecular weight of 302.25 g/mol. Its IUPAC name is 2,6-dichloro-4-[(4-propan-2-ylcyclohexyl)amino]phenol.
| Compound Name | 2,6-dichloro-4-[(4-propan-2-ylcyclohexyl)amino]phenol |
|---|---|
| PubChem CID | 107679381 |
| Molecular Formula | C15H21Cl2NO |
| Molecular Weight | 302.25 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 2,6-dichloro-4-[(4-propan-2-ylcyclohexyl)amino]phenol |
| SMILES | CC(C)C1CCC(Nc2cc(Cl)c(O)c(Cl)c2)CC1 |
| InChI | InChI=1S/C15H21Cl2NO/c1-9(2)10-3-5-11(6-4-10)18-12-7-13(16)15(19)14(17)8-12/h7-11,18-19H,3-6H2,1-2H3 |
| InChIKey | KCMXGCHITJQJTB-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.25 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|