C12H15Cl2FN2 — CID 107572825
N-(3,5-dichloro-4-fluorophenyl)azepan-4-amine (PubChem CID 107572825) has the molecular formula C12H15Cl2FN2 and a molecular weight of 277.17 g/mol. Its IUPAC name is N-(3,5-dichloro-4-fluorophenyl)azepan-4-amine.
| Compound Name | N-(3,5-dichloro-4-fluorophenyl)azepan-4-amine |
|---|---|
| PubChem CID | 107572825 |
| Molecular Formula | C12H15Cl2FN2 |
| Molecular Weight | 277.17 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | N-(3,5-dichloro-4-fluorophenyl)azepan-4-amine |
| SMILES | Fc1c(Cl)cc(NC2CCCNCC2)cc1Cl |
| InChI | InChI=1S/C12H15Cl2FN2/c13-10-6-9(7-11(14)12(10)15)17-8-2-1-4-16-5-3-8/h6-8,16-17H,1-5H2 |
| InChIKey | OWWVACAQNFZCBH-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.17 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|