C14H20N4O2 — CID 103980762
5-(azepan-4-ylamino)benzene-1,3-dicarboxamide (PubChem CID 103980762) has the molecular formula C14H20N4O2 and a molecular weight of 276.34 g/mol. Its IUPAC name is 5-(azepan-4-ylamino)benzene-1,3-dicarboxamide.
| Compound Name | 5-(azepan-4-ylamino)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 103980762 |
| Molecular Formula | C14H20N4O2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 5-(azepan-4-ylamino)benzene-1,3-dicarboxamide |
| SMILES | NC(=O)c1cc(NC2CCCNCC2)cc(C(N)=O)c1 |
| InChI | InChI=1S/C14H20N4O2/c15-13(19)9-6-10(14(16)20)8-12(7-9)18-11-2-1-4-17-5-3-11/h6-8,11,17-18H,1-5H2,(H2,15,19)(H2,16,20) |
| InChIKey | RWFUIBOFPOGUBR-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |