C15H21N3O2 — CID 43206245
5-[(2-methylcyclohexyl)amino]benzene-1,3-dicarboxamide (PubChem CID 43206245) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is 5-[(2-methylcyclohexyl)amino]benzene-1,3-dicarboxamide.
| Compound Name | 5-[(2-methylcyclohexyl)amino]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 43206245 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 5-[(2-methylcyclohexyl)amino]benzene-1,3-dicarboxamide |
| SMILES | CC1CCCCC1Nc1cc(C(N)=O)cc(C(N)=O)c1 |
| InChI | InChI=1S/C15H21N3O2/c1-9-4-2-3-5-13(9)18-12-7-10(14(16)19)6-11(8-12)15(17)20/h6-9,13,18H,2-5H2,1H3,(H2,16,19)(H2,17,20) |
| InChIKey | XSRMMKLHWNEOPO-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |