C14H19ClN2O2 — CID 103981021
N-(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)azepan-4-amine (PubChem CID 103981021) has the molecular formula C14H19ClN2O2 and a molecular weight of 282.77 g/mol. Its IUPAC name is N-(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)azepan-4-amine.
| Compound Name | N-(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)azepan-4-amine |
|---|---|
| PubChem CID | 103981021 |
| Molecular Formula | C14H19ClN2O2 |
| Molecular Weight | 282.77 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | N-(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)azepan-4-amine |
| SMILES | Clc1cc2c(cc1NC1CCCNCC1)OCCO2 |
| InChI | InChI=1S/C14H19ClN2O2/c15-11-8-13-14(19-7-6-18-13)9-12(11)17-10-2-1-4-16-5-3-10/h8-10,16-17H,1-7H2 |
| InChIKey | DYJJTONZNRLIEL-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.77 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|