C15H20ClNO2 — CID 43685795
6-chloro-N-(4-ethylcyclohexyl)-1,3-benzodioxol-5-amine (PubChem CID 43685795) has the molecular formula C15H20ClNO2 and a molecular weight of 281.78 g/mol. Its IUPAC name is 6-chloro-N-(4-ethylcyclohexyl)-1,3-benzodioxol-5-amine.
| Compound Name | 6-chloro-N-(4-ethylcyclohexyl)-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 43685795 |
| Molecular Formula | C15H20ClNO2 |
| Molecular Weight | 281.78 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 6-chloro-N-(4-ethylcyclohexyl)-1,3-benzodioxol-5-amine |
| SMILES | CCC1CCC(Nc2cc3c(cc2Cl)OCO3)CC1 |
| InChI | InChI=1S/C15H20ClNO2/c1-2-10-3-5-11(6-4-10)17-13-8-15-14(7-12(13)16)18-9-19-15/h7-8,10-11,17H,2-6,9H2,1H3 |
| InChIKey | SNSXPAWFXISQRV-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.78 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|