C12H14ClNO2S — CID 102672773
6-chloro-N-(2-methylthiolan-3-yl)-1,3-benzodioxol-5-amine (PubChem CID 102672773) has the molecular formula C12H14ClNO2S and a molecular weight of 271.77 g/mol. Its IUPAC name is 6-chloro-N-(2-methylthiolan-3-yl)-1,3-benzodioxol-5-amine.
| Compound Name | 6-chloro-N-(2-methylthiolan-3-yl)-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 102672773 |
| Molecular Formula | C12H14ClNO2S |
| Molecular Weight | 271.77 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | 6-chloro-N-(2-methylthiolan-3-yl)-1,3-benzodioxol-5-amine |
| SMILES | CC1SCCC1Nc1cc2c(cc1Cl)OCO2 |
| InChI | InChI=1S/C12H14ClNO2S/c1-7-9(2-3-17-7)14-10-5-12-11(4-8(10)13)15-6-16-12/h4-5,7,9,14H,2-3,6H2,1H3 |
| InChIKey | KROXVHAKGJPJQL-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.77 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|