C13H16ClNO4S — CID 65044607
6-chloro-N-(2-methylsulfonylcyclopentyl)-1,3-benzodioxol-5-amine (PubChem CID 65044607) has the molecular formula C13H16ClNO4S and a molecular weight of 317.79 g/mol. Its IUPAC name is 6-chloro-N-(2-methylsulfonylcyclopentyl)-1,3-benzodioxol-5-amine.
| Compound Name | 6-chloro-N-(2-methylsulfonylcyclopentyl)-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 65044607 |
| Molecular Formula | C13H16ClNO4S |
| Molecular Weight | 317.79 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 6-chloro-N-(2-methylsulfonylcyclopentyl)-1,3-benzodioxol-5-amine |
| SMILES | CS(=O)(=O)C1CCCC1Nc1cc2c(cc1Cl)OCO2 |
| InChI | InChI=1S/C13H16ClNO4S/c1-20(16,17)13-4-2-3-9(13)15-10-6-12-11(5-8(10)14)18-7-19-12/h5-6,9,13,15H,2-4,7H2,1H3 |
| InChIKey | CBXCQECVABSFSY-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.79 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|