C12H15BrClNO2S — CID 103478396
2-bromo-3-chloro-N-(2-methylsulfonylcyclopentyl)aniline (PubChem CID 103478396) has the molecular formula C12H15BrClNO2S and a molecular weight of 352.68 g/mol. Its IUPAC name is 2-bromo-3-chloro-N-(2-methylsulfonylcyclopentyl)aniline.
| Compound Name | 2-bromo-3-chloro-N-(2-methylsulfonylcyclopentyl)aniline |
|---|---|
| PubChem CID | 103478396 |
| Molecular Formula | C12H15BrClNO2S |
| Molecular Weight | 352.68 g/mol |
| Exact Mass | 350.97 |
| IUPAC Name | 2-bromo-3-chloro-N-(2-methylsulfonylcyclopentyl)aniline |
| SMILES | CS(=O)(=O)C1CCCC1Nc1cccc(Cl)c1Br |
| InChI | InChI=1S/C12H15BrClNO2S/c1-18(16,17)11-7-3-5-9(11)15-10-6-2-4-8(14)12(10)13/h2,4,6,9,11,15H,3,5,7H2,1H3 |
| InChIKey | GZYQMEWZJICQBF-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.68 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |