C12H16ClNO2 — CID 43685886
6-chloro-N-pentan-3-yl-1,3-benzodioxol-5-amine (PubChem CID 43685886) has the molecular formula C12H16ClNO2 and a molecular weight of 241.72 g/mol. Its IUPAC name is 6-chloro-N-pentan-3-yl-1,3-benzodioxol-5-amine.
| Compound Name | 6-chloro-N-pentan-3-yl-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 43685886 |
| Molecular Formula | C12H16ClNO2 |
| Molecular Weight | 241.72 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 6-chloro-N-pentan-3-yl-1,3-benzodioxol-5-amine |
| SMILES | CCC(CC)Nc1cc2c(cc1Cl)OCO2 |
| InChI | InChI=1S/C12H16ClNO2/c1-3-8(4-2)14-10-6-12-11(5-9(10)13)15-7-16-12/h5-6,8,14H,3-4,7H2,1-2H3 |
| InChIKey | WGUKODIQVSYISH-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.72 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|