C15H12ClF2NO2 — CID 43685834
6-chloro-N-[1-(2,4-difluorophenyl)ethyl]-1,3-benzodioxol-5-amine (PubChem CID 43685834) has the molecular formula C15H12ClF2NO2 and a molecular weight of 311.72 g/mol. Its IUPAC name is 6-chloro-N-[1-(2,4-difluorophenyl)ethyl]-1,3-benzodioxol-5-amine.
| Compound Name | 6-chloro-N-[1-(2,4-difluorophenyl)ethyl]-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 43685834 |
| Molecular Formula | C15H12ClF2NO2 |
| Molecular Weight | 311.72 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | 6-chloro-N-[1-(2,4-difluorophenyl)ethyl]-1,3-benzodioxol-5-amine |
| SMILES | CC(Nc1cc2c(cc1Cl)OCO2)c1ccc(F)cc1F |
| InChI | InChI=1S/C15H12ClF2NO2/c1-8(10-3-2-9(17)4-12(10)18)19-13-6-15-14(5-11(13)16)20-7-21-15/h2-6,8,19H,7H2,1H3 |
| InChIKey | KMJYDIWQDBSDOB-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.72 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|