C15H14ClF2N — CID 107631161
2-chloro-N-[1-(2,4-difluorophenyl)ethyl]-5-methylaniline (PubChem CID 107631161) has the molecular formula C15H14ClF2N and a molecular weight of 281.73 g/mol. Its IUPAC name is 2-chloro-N-[1-(2,4-difluorophenyl)ethyl]-5-methylaniline.
| Compound Name | 2-chloro-N-[1-(2,4-difluorophenyl)ethyl]-5-methylaniline |
|---|---|
| PubChem CID | 107631161 |
| Molecular Formula | C15H14ClF2N |
| Molecular Weight | 281.73 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 2-chloro-N-[1-(2,4-difluorophenyl)ethyl]-5-methylaniline |
| SMILES | Cc1ccc(Cl)c(NC(C)c2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C15H14ClF2N/c1-9-3-6-13(16)15(7-9)19-10(2)12-5-4-11(17)8-14(12)18/h3-8,10,19H,1-2H3 |
| InChIKey | CJZWEVYUAZZANX-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.73 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |