C15H14ClNO3 — CID 43685872
4-[1-[(6-chloro-1,3-benzodioxol-5-yl)amino]ethyl]phenol (PubChem CID 43685872) has the molecular formula C15H14ClNO3 and a molecular weight of 291.73 g/mol. Its IUPAC name is 4-[1-[(6-chloro-1,3-benzodioxol-5-yl)amino]ethyl]phenol.
| Compound Name | 4-[1-[(6-chloro-1,3-benzodioxol-5-yl)amino]ethyl]phenol |
|---|---|
| PubChem CID | 43685872 |
| Molecular Formula | C15H14ClNO3 |
| Molecular Weight | 291.73 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 4-[1-[(6-chloro-1,3-benzodioxol-5-yl)amino]ethyl]phenol |
| SMILES | CC(Nc1cc2c(cc1Cl)OCO2)c1ccc(O)cc1 |
| InChI | InChI=1S/C15H14ClNO3/c1-9(10-2-4-11(18)5-3-10)17-13-7-15-14(6-12(13)16)19-8-20-15/h2-7,9,17-18H,8H2,1H3 |
| InChIKey | DGQKKLOYCWDIOS-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.73 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|