C16H17NO3 — CID 43202737
4-[1-(1,3-benzodioxol-5-ylmethylamino)ethyl]phenol (PubChem CID 43202737) has the molecular formula C16H17NO3 and a molecular weight of 271.32 g/mol. Its IUPAC name is 4-[1-(1,3-benzodioxol-5-ylmethylamino)ethyl]phenol.
| Compound Name | 4-[1-(1,3-benzodioxol-5-ylmethylamino)ethyl]phenol |
|---|---|
| PubChem CID | 43202737 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 4-[1-(1,3-benzodioxol-5-ylmethylamino)ethyl]phenol |
| SMILES | CC(NCc1ccc2c(c1)OCO2)c1ccc(O)cc1 |
| InChI | InChI=1S/C16H17NO3/c1-11(13-3-5-14(18)6-4-13)17-9-12-2-7-15-16(8-12)20-10-19-15/h2-8,11,17-18H,9-10H2,1H3 |
| InChIKey | UFAWWXVBBWCEBT-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |