C12H14N2O2 — CID 62906978
3-(1,3-benzodioxol-5-ylmethylamino)butanenitrile (PubChem CID 62906978) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-ylmethylamino)butanenitrile.
| Compound Name | 3-(1,3-benzodioxol-5-ylmethylamino)butanenitrile |
|---|---|
| PubChem CID | 62906978 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 3-(1,3-benzodioxol-5-ylmethylamino)butanenitrile |
| SMILES | CC(CC#N)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C12H14N2O2/c1-9(4-5-13)14-7-10-2-3-11-12(6-10)16-8-15-11/h2-3,6,9,14H,4,7-8H2,1H3 |
| InChIKey | PDGQJZDAUAPAIG-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 54.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |