C12H14F3NO2 — CID 103775477
N-(1,3-benzodioxol-5-ylmethyl)-4,4,4-trifluorobutan-2-amine (PubChem CID 103775477) has the molecular formula C12H14F3NO2 and a molecular weight of 261.24 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-4,4,4-trifluorobutan-2-amine.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-4,4,4-trifluorobutan-2-amine |
|---|---|
| PubChem CID | 103775477 |
| Molecular Formula | C12H14F3NO2 |
| Molecular Weight | 261.24 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-4,4,4-trifluorobutan-2-amine |
| SMILES | CC(CC(F)(F)F)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C12H14F3NO2/c1-8(5-12(13,14)15)16-6-9-2-3-10-11(4-9)18-7-17-10/h2-4,8,16H,5-7H2,1H3 |
| InChIKey | PIFVNUAAYKFTIO-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.24 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |