C15H16N2O2 — CID 28649895
(1R)-N-(1,3-benzodioxol-5-ylmethyl)-1-pyridin-2-ylethanamine (PubChem CID 28649895) has the molecular formula C15H16N2O2 and a molecular weight of 256.31 g/mol. Its IUPAC name is (1R)-N-(1,3-benzodioxol-5-ylmethyl)-1-pyridin-2-ylethanamine.
| Compound Name | (1R)-N-(1,3-benzodioxol-5-ylmethyl)-1-pyridin-2-ylethanamine |
|---|---|
| PubChem CID | 28649895 |
| Molecular Formula | C15H16N2O2 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | (1R)-N-(1,3-benzodioxol-5-ylmethyl)-1-pyridin-2-ylethanamine |
| SMILES | C[C@@H](NCc1ccc2c(c1)OCO2)c1ccccn1 |
| InChI | InChI=1S/C15H16N2O2/c1-11(13-4-2-3-7-16-13)17-9-12-5-6-14-15(8-12)19-10-18-14/h2-8,11,17H,9-10H2,1H3/t11-/m1/s1 |
| InChIKey | WLHPVKCBUOIBMR-LLVKDONJSA-N |
| XLogP | 2.66 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |