C15H12N2O2 — CID 121107553
3-(1,3-benzodioxol-5-yl)-2-pyridin-2-ylpropanenitrile (PubChem CID 121107553) has the molecular formula C15H12N2O2 and a molecular weight of 252.27 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-2-pyridin-2-ylpropanenitrile.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-2-pyridin-2-ylpropanenitrile |
|---|---|
| PubChem CID | 121107553 |
| Molecular Formula | C15H12N2O2 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-2-pyridin-2-ylpropanenitrile |
| SMILES | N#CC(Cc1ccc2c(c1)OCO2)c1ccccn1 |
| InChI | InChI=1S/C15H12N2O2/c16-9-12(13-3-1-2-6-17-13)7-11-4-5-14-15(8-11)19-10-18-14/h1-6,8,12H,7,10H2 |
| InChIKey | XHNNBULCROGWPH-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 55.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |