C21H17ClN2O3 — CID 110373610
N-(1,3-benzodioxol-5-ylmethyl)-2-(4-chlorophenyl)-2-pyridin-2-ylacetamide (PubChem CID 110373610) has the molecular formula C21H17ClN2O3 and a molecular weight of 380.83 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2-(4-chlorophenyl)-2-pyridin-2-ylacetamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2-(4-chlorophenyl)-2-pyridin-2-ylacetamide |
|---|---|
| PubChem CID | 110373610 |
| Molecular Formula | C21H17ClN2O3 |
| Molecular Weight | 380.83 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2-(4-chlorophenyl)-2-pyridin-2-ylacetamide |
| SMILES | O=C(NCc1ccc2c(c1)OCO2)C(c1ccc(Cl)cc1)c1ccccn1 |
| InChI | InChI=1S/C21H17ClN2O3/c22-16-7-5-15(6-8-16)20(17-3-1-2-10-23-17)21(25)24-12-14-4-9-18-19(11-14)27-13-26-18/h1-11,20H,12-13H2,(H,24,25) |
| InChIKey | WWKPBBAPDWFQLS-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.83 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |