C19H17NO3 — CID 10542761
2-(1,3-benzodioxol-5-yl)-4-(4-ethylphenyl)-4-oxobutanenitrile (PubChem CID 10542761) has the molecular formula C19H17NO3 and a molecular weight of 307.35 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-4-(4-ethylphenyl)-4-oxobutanenitrile.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-4-(4-ethylphenyl)-4-oxobutanenitrile |
|---|---|
| PubChem CID | 10542761 |
| Molecular Formula | C19H17NO3 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-4-(4-ethylphenyl)-4-oxobutanenitrile |
| SMILES | CCc1ccc(C(=O)CC(C#N)c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C19H17NO3/c1-2-13-3-5-14(6-4-13)17(21)9-16(11-20)15-7-8-18-19(10-15)23-12-22-18/h3-8,10,16H,2,9,12H2,1H3 |
| InChIKey | HLCPNKORKQOCGO-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |