C18H16O6 — CID 83954111
2-(1,3-benzodioxol-5-yl)-3-(4-methoxycarbonylphenyl)propanoic acid (PubChem CID 83954111) has the molecular formula C18H16O6 and a molecular weight of 328.32 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-3-(4-methoxycarbonylphenyl)propanoic acid.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-3-(4-methoxycarbonylphenyl)propanoic acid |
|---|---|
| PubChem CID | 83954111 |
| Molecular Formula | C18H16O6 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-3-(4-methoxycarbonylphenyl)propanoic acid |
| SMILES | COC(=O)c1ccc(CC(C(=O)O)c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C18H16O6/c1-22-18(21)12-4-2-11(3-5-12)8-14(17(19)20)13-6-7-15-16(9-13)24-10-23-15/h2-7,9,14H,8,10H2,1H3,(H,19,20) |
| InChIKey | ZXHZHMCVNGOBRP-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |