C12H15NO4 — CID 82083822
2-(1,3-benzodioxol-5-yl)-3-(dimethylamino)propanoic acid (PubChem CID 82083822) has the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-3-(dimethylamino)propanoic acid.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-3-(dimethylamino)propanoic acid |
|---|---|
| PubChem CID | 82083822 |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-3-(dimethylamino)propanoic acid |
| SMILES | CN(C)CC(C(=O)O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C12H15NO4/c1-13(2)6-9(12(14)15)8-3-4-10-11(5-8)17-7-16-10/h3-5,9H,6-7H2,1-2H3,(H,14,15) |
| InChIKey | WTOOVVBLVKTZHE-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |