2-(1,3-benzodioxol-5-yl)-3-(3-chlorophenyl)propanoic acid

C16H13ClO4 — CID 82139562

IUPAC2-(1,3-benzodioxol-5-yl)-3-(3-chlorophenyl)propanoic acid
SMILESO=C(O)C(Cc1cccc(Cl)c1)c1ccc2c(c1)OCO2
InChIInChI=1S/C16H13ClO4/c17-12-3-1-2-10(6-12)7-13(16(18)19)11-4-5-14-15(8-11)21-9-20-14/h1-6,8,13H,7,9H2,(H,18,19)
InChIKeyINBDNTOOMAICBZ-UHFFFAOYSA-N
MW304.73 g/mol
LogP3.48
Rot. Bonds4

About 2-(1,3-benzodioxol-5-yl)-3-(3-chlorophenyl)propanoic acid

2-(1,3-benzodioxol-5-yl)-3-(3-chlorophenyl)propanoic acid (PubChem CID 82139562) has the molecular formula C16H13ClO4 and a molecular weight of 304.73 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-3-(3-chlorophenyl)propanoic acid.

Molecular Properties

Compound Name2-(1,3-benzodioxol-5-yl)-3-(3-chlorophenyl)propanoic acid
PubChem CID82139562
Molecular FormulaC16H13ClO4
Molecular Weight304.73 g/mol
Exact Mass304.05
IUPAC Name2-(1,3-benzodioxol-5-yl)-3-(3-chlorophenyl)propanoic acid
SMILESO=C(O)C(Cc1cccc(Cl)c1)c1ccc2c(c1)OCO2
InChIInChI=1S/C16H13ClO4/c17-12-3-1-2-10(6-12)7-13(16(18)19)11-4-5-14-15(8-11)21-9-20-14/h1-6,8,13H,7,9H2,(H,18,19)
InChIKeyINBDNTOOMAICBZ-UHFFFAOYSA-N
XLogP3.48
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500304.73
LogP ≤ 53.48
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(1,3-benzodioxol-5-yl)-3-(3-chlorophenyl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1,3-benzodioxol-5-yl)-3-(3-chlorophenyl)propanoic acid?
The IUPAC name of 2-(1,3-benzodioxol-5-yl)-3-(3-chlorophenyl)propanoic acid (CID 82139562) is 2-(1,3-benzodioxol-5-yl)-3-(3-chlorophenyl)propanoic acid.
What is the SMILES notation for 2-(1,3-benzodioxol-5-yl)-3-(3-chlorophenyl)propanoic acid?
The canonical SMILES for 2-(1,3-benzodioxol-5-yl)-3-(3-chlorophenyl)propanoic acid is O=C(O)C(Cc1cccc(Cl)c1)c1ccc2c(c1)OCO2.
What is the InChIKey of 2-(1,3-benzodioxol-5-yl)-3-(3-chlorophenyl)propanoic acid?
The InChIKey is INBDNTOOMAICBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13ClO4/c17-12-3-1-2-10(6-12)7-13(16(18)19)11-4-5-14-15(8-11)21-9-20-14/h1-6,8,13H,7,9H2,(H,18,19).
What are the key properties of 2-(1,3-benzodioxol-5-yl)-3-(3-chlorophenyl)propanoic acid?
2-(1,3-benzodioxol-5-yl)-3-(3-chlorophenyl)propanoic acid has a molecular weight of 304.73 g/mol, XLogP of 3.48, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-benzodioxol-5-yl)-3-(3-chlorophenyl)propanoic acid is sourced from PubChem (CID 82139562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).