C16H13ClO4 — CID 82139562
2-(1,3-benzodioxol-5-yl)-3-(3-chlorophenyl)propanoic acid (PubChem CID 82139562) has the molecular formula C16H13ClO4 and a molecular weight of 304.73 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-3-(3-chlorophenyl)propanoic acid.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-3-(3-chlorophenyl)propanoic acid |
|---|---|
| PubChem CID | 82139562 |
| Molecular Formula | C16H13ClO4 |
| Molecular Weight | 304.73 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-3-(3-chlorophenyl)propanoic acid |
| SMILES | O=C(O)C(Cc1cccc(Cl)c1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H13ClO4/c17-12-3-1-2-10(6-12)7-13(16(18)19)11-4-5-14-15(8-11)21-9-20-14/h1-6,8,13H,7,9H2,(H,18,19) |
| InChIKey | INBDNTOOMAICBZ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.73 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |