About 6-chloro-N-[1-(1,3-thiazol-2-yl)ethyl]-1,3-benzodioxol-5-amine
6-chloro-N-[1-(1,3-thiazol-2-yl)ethyl]-1,3-benzodioxol-5-amine (PubChem CID 64993019) has the molecular formula C12H11ClN2O2S
and a molecular weight of 282.75 g/mol. Its IUPAC name is 6-chloro-N-[1-(1,3-thiazol-2-yl)ethyl]-1,3-benzodioxol-5-amine.
Molecular Properties
| Compound Name | 6-chloro-N-[1-(1,3-thiazol-2-yl)ethyl]-1,3-benzodioxol-5-amine |
| PubChem CID | 64993019 |
| Molecular Formula | C12H11ClN2O2S |
| Molecular Weight | 282.75 g/mol |
| Exact Mass | 282.02 |
| IUPAC Name | 6-chloro-N-[1-(1,3-thiazol-2-yl)ethyl]-1,3-benzodioxol-5-amine |
| SMILES | CC(Nc1cc2c(cc1Cl)OCO2)c1nccs1 |
| InChI | InChI=1S/C12H11ClN2O2S/c1-7(12-14-2-3-18-12)15-9-5-11-10(4-8(9)13)16-6-17-11/h2-5,7,15H,6H2,1H3 |
| InChIKey | ZXYXHFDACNYIIZ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.75 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-N-[1-(1,3-thiazol-2-yl)ethyl]-1,3-benzodioxol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-N-[1-(1,3-thiazol-2-yl)ethyl]-1,3-benzodioxol-5-amine?
The IUPAC name of 6-chloro-N-[1-(1,3-thiazol-2-yl)ethyl]-1,3-benzodioxol-5-amine (CID 64993019) is 6-chloro-N-[1-(1,3-thiazol-2-yl)ethyl]-1,3-benzodioxol-5-amine.
What is the SMILES notation for 6-chloro-N-[1-(1,3-thiazol-2-yl)ethyl]-1,3-benzodioxol-5-amine?
The canonical SMILES for 6-chloro-N-[1-(1,3-thiazol-2-yl)ethyl]-1,3-benzodioxol-5-amine is CC(Nc1cc2c(cc1Cl)OCO2)c1nccs1.
What is the InChIKey of 6-chloro-N-[1-(1,3-thiazol-2-yl)ethyl]-1,3-benzodioxol-5-amine?
The InChIKey is ZXYXHFDACNYIIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11ClN2O2S/c1-7(12-14-2-3-18-12)15-9-5-11-10(4-8(9)13)16-6-17-11/h2-5,7,15H,6H2,1H3.
What are the key properties of 6-chloro-N-[1-(1,3-thiazol-2-yl)ethyl]-1,3-benzodioxol-5-amine?
6-chloro-N-[1-(1,3-thiazol-2-yl)ethyl]-1,3-benzodioxol-5-amine has a molecular weight of 282.75 g/mol, XLogP of 3.70, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-N-[1-(1,3-thiazol-2-yl)ethyl]-1,3-benzodioxol-5-amine is sourced from PubChem (CID 64993019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).