C14H14ClNO3 — CID 55181891
6-chloro-N-[1-(furan-2-yl)propan-2-yl]-1,3-benzodioxol-5-amine (PubChem CID 55181891) has the molecular formula C14H14ClNO3 and a molecular weight of 279.72 g/mol. Its IUPAC name is 6-chloro-N-[1-(furan-2-yl)propan-2-yl]-1,3-benzodioxol-5-amine.
| Compound Name | 6-chloro-N-[1-(furan-2-yl)propan-2-yl]-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 55181891 |
| Molecular Formula | C14H14ClNO3 |
| Molecular Weight | 279.72 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 6-chloro-N-[1-(furan-2-yl)propan-2-yl]-1,3-benzodioxol-5-amine |
| SMILES | CC(Cc1ccco1)Nc1cc2c(cc1Cl)OCO2 |
| InChI | InChI=1S/C14H14ClNO3/c1-9(5-10-3-2-4-17-10)16-12-7-14-13(6-11(12)15)18-8-19-14/h2-4,6-7,9,16H,5,8H2,1H3 |
| InChIKey | BNVMDIDAMGXGGG-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 43.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.72 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|