C15H16BrNO3 — CID 63085271
6-bromo-N-[1-(furan-2-yl)propan-2-yl]-2,3-dihydro-1,4-benzodioxin-7-amine (PubChem CID 63085271) has the molecular formula C15H16BrNO3 and a molecular weight of 338.20 g/mol. Its IUPAC name is 6-bromo-N-[1-(furan-2-yl)propan-2-yl]-2,3-dihydro-1,4-benzodioxin-7-amine.
| Compound Name | 6-bromo-N-[1-(furan-2-yl)propan-2-yl]-2,3-dihydro-1,4-benzodioxin-7-amine |
|---|---|
| PubChem CID | 63085271 |
| Molecular Formula | C15H16BrNO3 |
| Molecular Weight | 338.20 g/mol |
| Exact Mass | 337.03 |
| IUPAC Name | 6-bromo-N-[1-(furan-2-yl)propan-2-yl]-2,3-dihydro-1,4-benzodioxin-7-amine |
| SMILES | CC(Cc1ccco1)Nc1cc2c(cc1Br)OCCO2 |
| InChI | InChI=1S/C15H16BrNO3/c1-10(7-11-3-2-4-18-11)17-13-9-15-14(8-12(13)16)19-5-6-20-15/h2-4,8-10,17H,5-7H2,1H3 |
| InChIKey | WLEDGQMFCYPSIT-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 43.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.20 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|