C10H8ClNO2 — CID 63953885
6-chloro-N-prop-2-ynyl-1,3-benzodioxol-5-amine (PubChem CID 63953885) has the molecular formula C10H8ClNO2 and a molecular weight of 209.63 g/mol. Its IUPAC name is 6-chloro-N-prop-2-ynyl-1,3-benzodioxol-5-amine.
| Compound Name | 6-chloro-N-prop-2-ynyl-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 63953885 |
| Molecular Formula | C10H8ClNO2 |
| Molecular Weight | 209.63 g/mol |
| Exact Mass | 209.02 |
| IUPAC Name | 6-chloro-N-prop-2-ynyl-1,3-benzodioxol-5-amine |
| SMILES | C#CCNc1cc2c(cc1Cl)OCO2 |
| InChI | InChI=1S/C10H8ClNO2/c1-2-3-12-8-5-10-9(4-7(8)11)13-6-14-10/h1,4-5,12H,3,6H2 |
| InChIKey | PKCXANXZKLAVAW-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.63 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|