C12H11ClN2O2S — CID 43685912
6-chloro-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,3-benzodioxol-5-amine (PubChem CID 43685912) has the molecular formula C12H11ClN2O2S and a molecular weight of 282.75 g/mol. Its IUPAC name is 6-chloro-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,3-benzodioxol-5-amine.
| Compound Name | 6-chloro-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 43685912 |
| Molecular Formula | C12H11ClN2O2S |
| Molecular Weight | 282.75 g/mol |
| Exact Mass | 282.02 |
| IUPAC Name | 6-chloro-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,3-benzodioxol-5-amine |
| SMILES | Cc1nc(CNc2cc3c(cc2Cl)OCO3)cs1 |
| InChI | InChI=1S/C12H11ClN2O2S/c1-7-15-8(5-18-7)4-14-10-3-12-11(2-9(10)13)16-6-17-12/h2-3,5,14H,4,6H2,1H3 |
| InChIKey | PUVKRXXSXWWFHJ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.75 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|