C14H18F3N — CID 55193534
N-(4-ethylcyclohexyl)-2,3,5-trifluoroaniline (PubChem CID 55193534) has the molecular formula C14H18F3N and a molecular weight of 257.30 g/mol. Its IUPAC name is N-(4-ethylcyclohexyl)-2,3,5-trifluoroaniline.
| Compound Name | N-(4-ethylcyclohexyl)-2,3,5-trifluoroaniline |
|---|---|
| PubChem CID | 55193534 |
| Molecular Formula | C14H18F3N |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | N-(4-ethylcyclohexyl)-2,3,5-trifluoroaniline |
| SMILES | CCC1CCC(Nc2cc(F)cc(F)c2F)CC1 |
| InChI | InChI=1S/C14H18F3N/c1-2-9-3-5-11(6-4-9)18-13-8-10(15)7-12(16)14(13)17/h7-9,11,18H,2-6H2,1H3 |
| InChIKey | SZVJSOLPZFNWDX-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|