C13H16Cl2FN — CID 107572849
3,5-dichloro-4-fluoro-N-(4-methylcyclohexyl)aniline (PubChem CID 107572849) has the molecular formula C13H16Cl2FN and a molecular weight of 276.18 g/mol. Its IUPAC name is 3,5-dichloro-4-fluoro-N-(4-methylcyclohexyl)aniline.
| Compound Name | 3,5-dichloro-4-fluoro-N-(4-methylcyclohexyl)aniline |
|---|---|
| PubChem CID | 107572849 |
| Molecular Formula | C13H16Cl2FN |
| Molecular Weight | 276.18 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | 3,5-dichloro-4-fluoro-N-(4-methylcyclohexyl)aniline |
| SMILES | CC1CCC(Nc2cc(Cl)c(F)c(Cl)c2)CC1 |
| InChI | InChI=1S/C13H16Cl2FN/c1-8-2-4-9(5-3-8)17-10-6-11(14)13(16)12(15)7-10/h6-9,17H,2-5H2,1H3 |
| InChIKey | IXHPMONINUYBFO-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.18 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|