C16H14Cl2FN — CID 107572538
N-(3,5-dichloro-4-fluorophenyl)-1,2,3,4-tetrahydronaphthalen-2-amine (PubChem CID 107572538) has the molecular formula C16H14Cl2FN and a molecular weight of 310.20 g/mol. Its IUPAC name is N-(3,5-dichloro-4-fluorophenyl)-1,2,3,4-tetrahydronaphthalen-2-amine.
| Compound Name | N-(3,5-dichloro-4-fluorophenyl)-1,2,3,4-tetrahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 107572538 |
| Molecular Formula | C16H14Cl2FN |
| Molecular Weight | 310.20 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | N-(3,5-dichloro-4-fluorophenyl)-1,2,3,4-tetrahydronaphthalen-2-amine |
| SMILES | Fc1c(Cl)cc(NC2CCc3ccccc3C2)cc1Cl |
| InChI | InChI=1S/C16H14Cl2FN/c17-14-8-13(9-15(18)16(14)19)20-12-6-5-10-3-1-2-4-11(10)7-12/h1-4,8-9,12,20H,5-7H2 |
| InChIKey | BXCNOFUAWCJNJO-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.20 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|