C18H17N3 — CID 60943397
N-(1,2,3,4-tetrahydronaphthalen-2-yl)quinoxalin-6-amine (PubChem CID 60943397) has the molecular formula C18H17N3 and a molecular weight of 275.36 g/mol. Its IUPAC name is N-(1,2,3,4-tetrahydronaphthalen-2-yl)quinoxalin-6-amine.
| Compound Name | N-(1,2,3,4-tetrahydronaphthalen-2-yl)quinoxalin-6-amine |
|---|---|
| PubChem CID | 60943397 |
| Molecular Formula | C18H17N3 |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | N-(1,2,3,4-tetrahydronaphthalen-2-yl)quinoxalin-6-amine |
| SMILES | c1ccc2c(c1)CCC(Nc1ccc3nccnc3c1)C2 |
| InChI | InChI=1S/C18H17N3/c1-2-4-14-11-15(6-5-13(14)3-1)21-16-7-8-17-18(12-16)20-10-9-19-17/h1-4,7-10,12,15,21H,5-6,11H2 |
| InChIKey | XRMRZWBDHUMUNZ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |