methyl 3-(1,2,3,4-tetrahydronaphthalen-2-ylamino)benzoate

C18H19NO2 — CID 43774418

IUPACmethyl 3-(1,2,3,4-tetrahydronaphthalen-2-ylamino)benzoate
SMILESCOC(=O)c1cccc(NC2CCc3ccccc3C2)c1
InChIInChI=1S/C18H19NO2/c1-21-18(20)15-7-4-8-16(12-15)19-17-10-9-13-5-2-3-6-14(13)11-17/h2-8,12,17,19H,9-11H2,1H3
InChIKeyQJNVOTZRFRBGEK-UHFFFAOYSA-N
MW281.36 g/mol
LogP3.44
Rot. Bonds3

About methyl 3-(1,2,3,4-tetrahydronaphthalen-2-ylamino)benzoate

methyl 3-(1,2,3,4-tetrahydronaphthalen-2-ylamino)benzoate (PubChem CID 43774418) has the molecular formula C18H19NO2 and a molecular weight of 281.36 g/mol. Its IUPAC name is methyl 3-(1,2,3,4-tetrahydronaphthalen-2-ylamino)benzoate.

Molecular Properties

Compound Namemethyl 3-(1,2,3,4-tetrahydronaphthalen-2-ylamino)benzoate
PubChem CID43774418
Molecular FormulaC18H19NO2
Molecular Weight281.36 g/mol
Exact Mass281.14
IUPAC Namemethyl 3-(1,2,3,4-tetrahydronaphthalen-2-ylamino)benzoate
SMILESCOC(=O)c1cccc(NC2CCc3ccccc3C2)c1
InChIInChI=1S/C18H19NO2/c1-21-18(20)15-7-4-8-16(12-15)19-17-10-9-13-5-2-3-6-14(13)11-17/h2-8,12,17,19H,9-11H2,1H3
InChIKeyQJNVOTZRFRBGEK-UHFFFAOYSA-N
XLogP3.44
TPSA38.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500281.36
LogP ≤ 53.44
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl 3-(1,2,3,4-tetrahydronaphthalen-2-ylamino)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(1,2,3,4-tetrahydronaphthalen-2-ylamino)benzoate?
The IUPAC name of methyl 3-(1,2,3,4-tetrahydronaphthalen-2-ylamino)benzoate (CID 43774418) is methyl 3-(1,2,3,4-tetrahydronaphthalen-2-ylamino)benzoate.
What is the SMILES notation for methyl 3-(1,2,3,4-tetrahydronaphthalen-2-ylamino)benzoate?
The canonical SMILES for methyl 3-(1,2,3,4-tetrahydronaphthalen-2-ylamino)benzoate is COC(=O)c1cccc(NC2CCc3ccccc3C2)c1.
What is the InChIKey of methyl 3-(1,2,3,4-tetrahydronaphthalen-2-ylamino)benzoate?
The InChIKey is QJNVOTZRFRBGEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19NO2/c1-21-18(20)15-7-4-8-16(12-15)19-17-10-9-13-5-2-3-6-14(13)11-17/h2-8,12,17,19H,9-11H2,1H3.
What are the key properties of methyl 3-(1,2,3,4-tetrahydronaphthalen-2-ylamino)benzoate?
methyl 3-(1,2,3,4-tetrahydronaphthalen-2-ylamino)benzoate has a molecular weight of 281.36 g/mol, XLogP of 3.44, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(1,2,3,4-tetrahydronaphthalen-2-ylamino)benzoate is sourced from PubChem (CID 43774418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).